C27H27N3O4S2 — CID 53327891
(2R)-2-[[5-[2-(4-butylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-N-hydroxy-3-(1H-indol-3-yl)propanamide (PubChem CID 53327891) has the molecular formula C27H27N3O4S2 and a molecular weight of 521.66 g/mol. Its IUPAC name is (2R)-2-[[5-[2-(4-butylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-N-hydroxy-3-(1H-indol-3-yl)propanamide.
| Compound Name | (2R)-2-[[5-[2-(4-butylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-N-hydroxy-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 53327891 |
| Molecular Formula | C27H27N3O4S2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | (2R)-2-[[5-[2-(4-butylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-N-hydroxy-3-(1H-indol-3-yl)propanamide |
| SMILES | CCCCc1ccc(C#Cc2ccc(S(=O)(=O)N[C@H](Cc3c[nH]c4ccccc34)C(=O)NO)s2)cc1 |
| InChI | InChI=1S/C27H27N3O4S2/c1-2-3-6-19-9-11-20(12-10-19)13-14-22-15-16-26(35-22)36(33,34)30-25(27(31)29-32)17-21-18-28-24-8-5-4-7-23(21)24/h4-5,7-12,15-16,18,25,28,30,32H,2-3,6,17H2,1H3,(H,29,31)/t25-/m1/s1 |
| InChIKey | RSAGFYGPXOAVNX-RUZDIDTESA-N |
| XLogP | 4.37 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|