C30H28N2O6S — CID 67589103
methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-[4-(3-methoxy-3-oxopropyl)phenyl]ethynyl]phenyl]sulfonylamino]propanoate (PubChem CID 67589103) has the molecular formula C30H28N2O6S and a molecular weight of 544.63 g/mol. Its IUPAC name is methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-[4-(3-methoxy-3-oxopropyl)phenyl]ethynyl]phenyl]sulfonylamino]propanoate.
| Compound Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-[4-(3-methoxy-3-oxopropyl)phenyl]ethynyl]phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 67589103 |
| Molecular Formula | C30H28N2O6S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-[4-(3-methoxy-3-oxopropyl)phenyl]ethynyl]phenyl]sulfonylamino]propanoate |
| SMILES | COC(=O)CCc1ccc(C#Cc2ccc(S(=O)(=O)N[C@H](Cc3c[nH]c4ccccc34)C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O6S/c1-37-29(33)18-15-22-10-7-21(8-11-22)9-12-23-13-16-25(17-14-23)39(35,36)32-28(30(34)38-2)19-24-20-31-27-6-4-3-5-26(24)27/h3-8,10-11,13-14,16-17,20,28,31-32H,15,18-19H2,1-2H3/t28-/m1/s1 |
| InChIKey | PYEGBGJUEJHPDN-MUUNZHRXSA-N |
| XLogP | 3.74 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|