C20H20N2O4S — CID 11794436
methyl (2R)-2-[(4-ethenylphenyl)sulfonylamino]-3-(1H-indol-3-yl)propanoate (PubChem CID 11794436) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is methyl (2R)-2-[(4-ethenylphenyl)sulfonylamino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2R)-2-[(4-ethenylphenyl)sulfonylamino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 11794436 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | methyl (2R)-2-[(4-ethenylphenyl)sulfonylamino]-3-(1H-indol-3-yl)propanoate |
| SMILES | C=Cc1ccc(S(=O)(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)OC)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-3-14-8-10-16(11-9-14)27(24,25)22-19(20(23)26-2)12-15-13-21-18-7-5-4-6-17(15)18/h3-11,13,19,21-22H,1,12H2,2H3/t19-/m1/s1 |
| InChIKey | JVWFEEIMFISRMO-LJQANCHMSA-N |
| XLogP | 2.87 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |