C27H24N2O5S — CID 10767330
methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]sulfonylamino]propanoate (PubChem CID 10767330) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]sulfonylamino]propanoate.
| Compound Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 10767330 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NS(=O)(=O)c1ccc(C#Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O5S/c1-33-22-13-9-19(10-14-22)7-8-20-11-15-23(16-12-20)35(31,32)29-26(27(30)34-2)17-21-18-28-25-6-4-3-5-24(21)25/h3-6,9-16,18,26,28-29H,17H2,1-2H3/t26-/m1/s1 |
| InChIKey | XCNBFKOWZVSFES-AREMUKBSSA-N |
| XLogP | 3.64 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|