C35H30N2O7S — CID 4315509
[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 4315509) has the molecular formula C35H30N2O7S and a molecular weight of 622.70 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 4315509 |
| Molecular Formula | C35H30N2O7S |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(-c2cc(=O)oc3c(C)c(OC(=O)C(Cc4c[nH]c5ccccc45)NS(=O)(=O)c4ccc(C)cc4)ccc23)cc1 |
| InChI | InChI=1S/C35H30N2O7S/c1-21-8-14-26(15-9-21)45(40,41)37-31(18-24-20-36-30-7-5-4-6-27(24)30)35(39)43-32-17-16-28-29(19-33(38)44-34(28)22(32)2)23-10-12-25(42-3)13-11-23/h4-17,19-20,31,36-37H,18H2,1-3H3 |
| InChIKey | CVKCLHYDALHTQZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|