C29H26N2O6S — CID 3664086
(4-ethyl-2-oxochromen-7-yl) 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 3664086) has the molecular formula C29H26N2O6S and a molecular weight of 530.60 g/mol. Its IUPAC name is (4-ethyl-2-oxochromen-7-yl) 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | (4-ethyl-2-oxochromen-7-yl) 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 3664086 |
| Molecular Formula | C29H26N2O6S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | (4-ethyl-2-oxochromen-7-yl) 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | CCc1cc(=O)oc2cc(OC(=O)C(Cc3c[nH]c4ccccc34)NS(=O)(=O)c3ccc(C)cc3)ccc12 |
| InChI | InChI=1S/C29H26N2O6S/c1-3-19-15-28(32)37-27-16-21(10-13-24(19)27)36-29(33)26(14-20-17-30-25-7-5-4-6-23(20)25)31-38(34,35)22-11-8-18(2)9-12-22/h4-13,15-17,26,30-31H,3,14H2,1-2H3 |
| InChIKey | CFOIFOCZOQJFHW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|