C24H21NO6S — CID 2043452
(6-oxobenzo[c]chromen-3-yl) (2S)-2-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 2043452) has the molecular formula C24H21NO6S and a molecular weight of 451.50 g/mol. Its IUPAC name is (6-oxobenzo[c]chromen-3-yl) (2S)-2-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | (6-oxobenzo[c]chromen-3-yl) (2S)-2-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 2043452 |
| Molecular Formula | C24H21NO6S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (6-oxobenzo[c]chromen-3-yl) (2S)-2-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | CC[C@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)Oc1ccc2c(c1)oc(=O)c1ccccc12 |
| InChI | InChI=1S/C24H21NO6S/c1-3-21(25-32(28,29)17-11-8-15(2)9-12-17)24(27)30-16-10-13-19-18-6-4-5-7-20(18)23(26)31-22(19)14-16/h4-14,21,25H,3H2,1-2H3/t21-/m0/s1 |
| InChIKey | PCHWWYVHQUYFQM-NRFANRHFSA-N |
| XLogP | 3.92 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|