C31H24N2O6S — CID 3825894
(6-oxobenzo[c]chromen-3-yl) 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 3825894) has the molecular formula C31H24N2O6S and a molecular weight of 552.61 g/mol. Its IUPAC name is (6-oxobenzo[c]chromen-3-yl) 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | (6-oxobenzo[c]chromen-3-yl) 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 3825894 |
| Molecular Formula | C31H24N2O6S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | (6-oxobenzo[c]chromen-3-yl) 3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2c[nH]c3ccccc23)C(=O)Oc2ccc3c(c2)oc(=O)c2ccccc23)cc1 |
| InChI | InChI=1S/C31H24N2O6S/c1-19-10-13-22(14-11-19)40(36,37)33-28(16-20-18-32-27-9-5-4-6-23(20)27)31(35)38-21-12-15-25-24-7-2-3-8-26(24)30(34)39-29(25)17-21/h2-15,17-18,28,32-33H,16H2,1H3 |
| InChIKey | DDWNKEWOBBYLQU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|