C24H22N2O4S — CID 118705392
1H-indol-3-yl (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 118705392) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 1H-indol-3-yl (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | 1H-indol-3-yl (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 118705392 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 1H-indol-3-yl (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)Oc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H22N2O4S/c1-17-11-13-19(14-12-17)31(28,29)26-22(15-18-7-3-2-4-8-18)24(27)30-23-16-25-21-10-6-5-9-20(21)23/h2-14,16,22,25-26H,15H2,1H3/t22-/m0/s1 |
| InChIKey | MEVCGMIJHJJNAZ-QFIPXVFZSA-N |
| XLogP | 3.97 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |