C18H18N2O4S — CID 4227873
1H-indol-3-yl 2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 4227873) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1H-indol-3-yl 2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | 1H-indol-3-yl 2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 4227873 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1H-indol-3-yl 2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)C(=O)Oc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-12-7-9-14(10-8-12)25(22,23)20-13(2)18(21)24-17-11-19-16-6-4-3-5-15(16)17/h3-11,13,19-20H,1-2H3 |
| InChIKey | CBIVSVOVPJAVRE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |