C10H12NO4S- — CID 6933874
(2R)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 6933874) has the molecular formula C10H12NO4S- and a molecular weight of 242.28 g/mol. Its IUPAC name is (2R)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | (2R)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 6933874 |
| Molecular Formula | C10H12NO4S- |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2R)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C)C(=O)[O-])cc1 |
| InChI | InChI=1S/C10H13NO4S/c1-7-3-5-9(6-4-7)16(14,15)11-8(2)10(12)13/h3-6,8,11H,1-2H3,(H,12,13)/p-1/t8-/m1/s1 |
| InChIKey | LQXKHFZRJYXXFA-MRVPVSSYSA-M |
| XLogP | -0.59 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |