C10H15NO5S — CID 131749441
(2S)-2-[(4-methylphenyl)sulfonylamino]propanoic acid;hydrate (PubChem CID 131749441) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is (2S)-2-[(4-methylphenyl)sulfonylamino]propanoic acid;hydrate.
| Compound Name | (2S)-2-[(4-methylphenyl)sulfonylamino]propanoic acid;hydrate |
|---|---|
| PubChem CID | 131749441 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2S)-2-[(4-methylphenyl)sulfonylamino]propanoic acid;hydrate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)C(=O)O)cc1.O |
| InChI | InChI=1S/C10H13NO4S.H2O/c1-7-3-5-9(6-4-7)16(14,15)11-8(2)10(12)13;/h3-6,8,11H,1-2H3,(H,12,13);1H2/t8-;/m0./s1 |
| InChIKey | DYULRIJKVZCPFY-QRPNPIFTSA-N |
| XLogP | -0.08 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |