C10H11NO5S — CID 89012126
(2R)-2-[(4-formylphenyl)sulfonylamino]propanoic acid (PubChem CID 89012126) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is (2R)-2-[(4-formylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[(4-formylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 89012126 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (2R)-2-[(4-formylphenyl)sulfonylamino]propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(C=O)cc1)C(=O)O |
| InChI | InChI=1S/C10H11NO5S/c1-7(10(13)14)11-17(15,16)9-4-2-8(6-12)3-5-9/h2-7,11H,1H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | GWSWSTBXIYEVFU-SSDOTTSWSA-N |
| XLogP | 0.25 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|