C12H17NO5S — CID 42254919
(2R)-2-[(4-propan-2-yloxyphenyl)sulfonylamino]propanoic acid (PubChem CID 42254919) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is (2R)-2-[(4-propan-2-yloxyphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[(4-propan-2-yloxyphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 42254919 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (2R)-2-[(4-propan-2-yloxyphenyl)sulfonylamino]propanoic acid |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N[C@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C12H17NO5S/c1-8(2)18-10-4-6-11(7-5-10)19(16,17)13-9(3)12(14)15/h4-9,13H,1-3H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | CQQNJDDHVBUGHK-SECBINFHSA-N |
| XLogP | 1.23 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |