C15H14ClNO4S — CID 51715390
(2R)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]propanoic acid (PubChem CID 51715390) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is (2R)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 51715390 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (2R)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C15H14ClNO4S/c1-10(15(18)19)17-22(20,21)14-8-4-12(5-9-14)11-2-6-13(16)7-3-11/h2-10,17H,1H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | OCNYVNAQYAVYKH-SNVBAGLBSA-N |
| XLogP | 2.76 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |