C17H20ClN2O6PS — CID 59898512
[(1R)-1-[[(2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]propanoyl]amino]ethyl]phosphonic acid (PubChem CID 59898512) has the molecular formula C17H20ClN2O6PS and a molecular weight of 446.85 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]propanoyl]amino]ethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]propanoyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 59898512 |
| Molecular Formula | C17H20ClN2O6PS |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]propanoyl]amino]ethyl]phosphonic acid |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)N[C@@H](C)P(=O)(O)O |
| InChI | InChI=1S/C17H20ClN2O6PS/c1-11(17(21)19-12(2)27(22,23)24)20-28(25,26)16-9-5-14(6-10-16)13-3-7-15(18)8-4-13/h3-12,20H,1-2H3,(H,19,21)(H2,22,23,24)/t11-,12+/m0/s1 |
| InChIKey | USUIAVMNPZARAK-NWDGAFQWSA-N |
| XLogP | 2.31 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|