C13H17ClN2O5S — CID 119237146
3-[2-[(4-chlorophenyl)sulfonylamino]propanoylamino]-2-methylpropanoic acid (PubChem CID 119237146) has the molecular formula C13H17ClN2O5S and a molecular weight of 348.81 g/mol. Its IUPAC name is 3-[2-[(4-chlorophenyl)sulfonylamino]propanoylamino]-2-methylpropanoic acid.
| Compound Name | 3-[2-[(4-chlorophenyl)sulfonylamino]propanoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119237146 |
| Molecular Formula | C13H17ClN2O5S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 3-[2-[(4-chlorophenyl)sulfonylamino]propanoylamino]-2-methylpropanoic acid |
| SMILES | CC(CNC(=O)C(C)NS(=O)(=O)c1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C13H17ClN2O5S/c1-8(13(18)19)7-15-12(17)9(2)16-22(20,21)11-5-3-10(14)4-6-11/h3-6,8-9,16H,7H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | TWGPJJQZKNMTDX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |