C9H9Cl2NO4S — CID 21236350
3-chloro-2-[(4-chlorophenyl)sulfonylamino]propanoic acid (PubChem CID 21236350) has the molecular formula C9H9Cl2NO4S and a molecular weight of 298.15 g/mol. Its IUPAC name is 3-chloro-2-[(4-chlorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-chloro-2-[(4-chlorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 21236350 |
| Molecular Formula | C9H9Cl2NO4S |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 3-chloro-2-[(4-chlorophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)C(CCl)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9Cl2NO4S/c10-5-8(9(13)14)12-17(15,16)7-3-1-6(11)2-4-7/h1-4,8,12H,5H2,(H,13,14) |
| InChIKey | JSJSRBIURYGZDO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|