C15H13Cl2NO4S — CID 1112091
(2S)-3-(4-chlorophenyl)-2-[(4-chlorophenyl)sulfonylamino]propanoic acid (PubChem CID 1112091) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is (2S)-3-(4-chlorophenyl)-2-[(4-chlorophenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-(4-chlorophenyl)-2-[(4-chlorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 1112091 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | (2S)-3-(4-chlorophenyl)-2-[(4-chlorophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(Cl)cc1)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2NO4S/c16-11-3-1-10(2-4-11)9-14(15(19)20)18-23(21,22)13-7-5-12(17)6-8-13/h1-8,14,18H,9H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | MBKIFDZRLANKGM-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |