C17H18ClNO5S — CID 5010476
methyl 3-(4-chlorophenyl)-2-[(4-methoxyphenyl)sulfonylamino]propanoate (PubChem CID 5010476) has the molecular formula C17H18ClNO5S and a molecular weight of 383.85 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-[(4-methoxyphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 5010476 |
| Molecular Formula | C17H18ClNO5S |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(Cl)cc1)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H18ClNO5S/c1-23-14-7-9-15(10-8-14)25(21,22)19-16(17(20)24-2)11-12-3-5-13(18)6-4-12/h3-10,16,19H,11H2,1-2H3 |
| InChIKey | YCJHORWNZVGFLU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |