C18H21NO5S — CID 101017331
ethyl 2-[(4-methoxyphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 101017331) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is ethyl 2-[(4-methoxyphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[(4-methoxyphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 101017331 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | ethyl 2-[(4-methoxyphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-3-24-18(20)17(13-14-7-5-4-6-8-14)19-25(21,22)16-11-9-15(23-2)10-12-16/h4-12,17,19H,3,13H2,1-2H3 |
| InChIKey | MMKDOKSFHZXNNY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |