C16H15ClNO5S- — CID 2338691
(2R)-3-(4-chlorophenyl)-2-[(4-methoxyphenyl)sulfonylamino]propanoate (PubChem CID 2338691) has the molecular formula C16H15ClNO5S- and a molecular weight of 368.82 g/mol. Its IUPAC name is (2R)-3-(4-chlorophenyl)-2-[(4-methoxyphenyl)sulfonylamino]propanoate.
| Compound Name | (2R)-3-(4-chlorophenyl)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 2338691 |
| Molecular Formula | C16H15ClNO5S- |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (2R)-3-(4-chlorophenyl)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](Cc2ccc(Cl)cc2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H16ClNO5S/c1-23-13-6-8-14(9-7-13)24(21,22)18-15(16(19)20)10-11-2-4-12(17)5-3-11/h2-9,15,18H,10H2,1H3,(H,19,20)/p-1/t15-/m1/s1 |
| InChIKey | UYZVOBZDHCEWGY-OAHLLOKOSA-M |
| XLogP | 0.99 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |