C12H16NO5S2- — CID 2404775
(2S)-2-[(4-methoxyphenyl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 2404775) has the molecular formula C12H16NO5S2- and a molecular weight of 318.40 g/mol. Its IUPAC name is (2S)-2-[(4-methoxyphenyl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[(4-methoxyphenyl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2404775 |
| Molecular Formula | C12H16NO5S2- |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (2S)-2-[(4-methoxyphenyl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](CCSC)C(=O)[O-])cc1 |
| InChI | InChI=1S/C12H17NO5S2/c1-18-9-3-5-10(6-4-9)20(16,17)13-11(12(14)15)7-8-19-2/h3-6,11,13H,7-8H2,1-2H3,(H,14,15)/p-1/t11-/m0/s1 |
| InChIKey | SHGHKXMUEWMGNJ-NSHDSACASA-M |
| XLogP | -0.15 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |