C18H21ClN2O5S2 — CID 43050042
(6-chloro-3-pyridinyl)methyl 2-[(4-methoxyphenyl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 43050042) has the molecular formula C18H21ClN2O5S2 and a molecular weight of 444.96 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 2-[(4-methoxyphenyl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 2-[(4-methoxyphenyl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 43050042 |
| Molecular Formula | C18H21ClN2O5S2 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 2-[(4-methoxyphenyl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | COc1ccc(S(=O)(=O)NC(CCSC)C(=O)OCc2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C18H21ClN2O5S2/c1-25-14-4-6-15(7-5-14)28(23,24)21-16(9-10-27-2)18(22)26-12-13-3-8-17(19)20-11-13/h3-8,11,16,21H,9-10,12H2,1-2H3 |
| InChIKey | BZIUXGIJIGNAOA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|