C11H15ClN2O3S2 — CID 18474632
2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanamide (PubChem CID 18474632) has the molecular formula C11H15ClN2O3S2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 18474632 |
| Molecular Formula | C11H15ClN2O3S2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(Cl)cc1)C(N)=O |
| InChI | InChI=1S/C11H15ClN2O3S2/c1-18-7-6-10(11(13)15)14-19(16,17)9-4-2-8(12)3-5-9/h2-5,10,14H,6-7H2,1H3,(H2,13,15) |
| InChIKey | JNPIPZDMUQYUNN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |