C16H24ClN3O4S2 — CID 30388461
4-chloro-N-[(2R)-1-[2-(3-methylbutanoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 30388461) has the molecular formula C16H24ClN3O4S2 and a molecular weight of 421.97 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-1-[2-(3-methylbutanoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2R)-1-[2-(3-methylbutanoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 30388461 |
| Molecular Formula | C16H24ClN3O4S2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 4-chloro-N-[(2R)-1-[2-(3-methylbutanoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | CSCC[C@@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)NNC(=O)CC(C)C |
| InChI | InChI=1S/C16H24ClN3O4S2/c1-11(2)10-15(21)18-19-16(22)14(8-9-25-3)20-26(23,24)13-6-4-12(17)5-7-13/h4-7,11,14,20H,8-10H2,1-3H3,(H,18,21)(H,19,22)/t14-/m1/s1 |
| InChIKey | TYRUZUUEHSMFOD-CQSZACIVSA-N |
| XLogP | 1.93 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|