C22H28ClN3O4S2 — CID 55863608
N-[4-(4-chloroanilino)-4-oxobutyl]-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide (PubChem CID 55863608) has the molecular formula C22H28ClN3O4S2 and a molecular weight of 498.07 g/mol. Its IUPAC name is N-[4-(4-chloroanilino)-4-oxobutyl]-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide.
| Compound Name | N-[4-(4-chloroanilino)-4-oxobutyl]-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 55863608 |
| Molecular Formula | C22H28ClN3O4S2 |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | N-[4-(4-chloroanilino)-4-oxobutyl]-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)NCCCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H28ClN3O4S2/c1-16-5-11-19(12-6-16)32(29,30)26-20(13-15-31-2)22(28)24-14-3-4-21(27)25-18-9-7-17(23)8-10-18/h5-12,20,26H,3-4,13-15H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | RPGNLBHCFGSYTN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|