C19H32N2O4S2 — CID 46652731
N-(3-butoxypropyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide (PubChem CID 46652731) has the molecular formula C19H32N2O4S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide.
| Compound Name | N-(3-butoxypropyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 46652731 |
| Molecular Formula | C19H32N2O4S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-(3-butoxypropyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide |
| SMILES | CCCCOCCCNC(=O)C(CCSC)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H32N2O4S2/c1-4-5-13-25-14-6-12-20-19(22)18(11-15-26-3)21-27(23,24)17-9-7-16(2)8-10-17/h7-10,18,21H,4-6,11-15H2,1-3H3,(H,20,22) |
| InChIKey | MTAOWGUOPCLOQV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|