C16H25BrN2O3S2 — CID 43002628
2-[(4-bromophenyl)sulfonylamino]-4-methylsulfanyl-N-pentylbutanamide (PubChem CID 43002628) has the molecular formula C16H25BrN2O3S2 and a molecular weight of 437.43 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonylamino]-4-methylsulfanyl-N-pentylbutanamide.
| Compound Name | 2-[(4-bromophenyl)sulfonylamino]-4-methylsulfanyl-N-pentylbutanamide |
|---|---|
| PubChem CID | 43002628 |
| Molecular Formula | C16H25BrN2O3S2 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonylamino]-4-methylsulfanyl-N-pentylbutanamide |
| SMILES | CCCCCNC(=O)C(CCSC)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H25BrN2O3S2/c1-3-4-5-11-18-16(20)15(10-12-23-2)19-24(21,22)14-8-6-13(17)7-9-14/h6-9,15,19H,3-5,10-12H2,1-2H3,(H,18,20) |
| InChIKey | QOZZDYVCSNHZKE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|