C21H26ClFN2O4S2 — CID 43060845
2-[(4-chlorophenyl)sulfonylamino]-N-[4-(4-fluorophenoxy)butyl]-4-methylsulfanylbutanamide (PubChem CID 43060845) has the molecular formula C21H26ClFN2O4S2 and a molecular weight of 489.03 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-[4-(4-fluorophenoxy)butyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[4-(4-fluorophenoxy)butyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 43060845 |
| Molecular Formula | C21H26ClFN2O4S2 |
| Molecular Weight | 489.03 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[4-(4-fluorophenoxy)butyl]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)NCCCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C21H26ClFN2O4S2/c1-30-15-12-20(25-31(27,28)19-10-4-16(22)5-11-19)21(26)24-13-2-3-14-29-18-8-6-17(23)7-9-18/h4-11,20,25H,2-3,12-15H2,1H3,(H,24,26) |
| InChIKey | ZDBUHOREQPEBFS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|