C11H13ClNO4S2- — CID 5055809
2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 5055809) has the molecular formula C11H13ClNO4S2- and a molecular weight of 322.82 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 5055809 |
| Molecular Formula | C11H13ClNO4S2- |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)[O-] |
| InChI | InChI=1S/C11H14ClNO4S2/c1-18-7-6-10(11(14)15)13-19(16,17)9-4-2-8(12)3-5-9/h2-5,10,13H,6-7H2,1H3,(H,14,15)/p-1 |
| InChIKey | GZEXLSPVDWIRGE-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |