C18H19ClN2O5S2 — CID 19032733
3-[[2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoyl]amino]benzoic acid (PubChem CID 19032733) has the molecular formula C18H19ClN2O5S2 and a molecular weight of 442.95 g/mol. Its IUPAC name is 3-[[2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoyl]amino]benzoic acid.
| Compound Name | 3-[[2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 19032733 |
| Molecular Formula | C18H19ClN2O5S2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 3-[[2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoyl]amino]benzoic acid |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H19ClN2O5S2/c1-27-10-9-16(21-28(25,26)15-7-5-13(19)6-8-15)17(22)20-14-4-2-3-12(11-14)18(23)24/h2-8,11,16,21H,9-10H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | ASLYUQJSWFKZGQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |