C14H20ClNO4S2 — CID 3250513
propan-2-yl 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 3250513) has the molecular formula C14H20ClNO4S2 and a molecular weight of 365.90 g/mol. Its IUPAC name is propan-2-yl 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3250513 |
| Molecular Formula | C14H20ClNO4S2 |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | propan-2-yl 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C14H20ClNO4S2/c1-10(2)20-14(17)13(8-9-21-3)16-22(18,19)12-6-4-11(15)5-7-12/h4-7,10,13,16H,8-9H2,1-3H3 |
| InChIKey | SWBJCWVFANTEFH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |