C15H23NO4S2 — CID 3569774
propan-2-yl 2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 3569774) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is propan-2-yl 2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl 2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3569774 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | propan-2-yl 2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C15H23NO4S2/c1-11(2)20-15(17)14(9-10-21-4)16-22(18,19)13-7-5-12(3)6-8-13/h5-8,11,14,16H,9-10H2,1-4H3 |
| InChIKey | MJHNEZSXZSUJTB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |