C22H30N2O3S2 — CID 46651070
N-(4-tert-butylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide (PubChem CID 46651070) has the molecular formula C22H30N2O3S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide.
| Compound Name | N-(4-tert-butylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 46651070 |
| Molecular Formula | C22H30N2O3S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30N2O3S2/c1-16-6-12-19(13-7-16)29(26,27)24-20(14-15-28-5)21(25)23-18-10-8-17(9-11-18)22(2,3)4/h6-13,20,24H,14-15H2,1-5H3,(H,23,25) |
| InChIKey | FNVKUVFRWSDZNL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |