C22H28FN3O3S2 — CID 55945310
N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide (PubChem CID 55945310) has the molecular formula C22H28FN3O3S2 and a molecular weight of 465.62 g/mol. Its IUPAC name is N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide.
| Compound Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 55945310 |
| Molecular Formula | C22H28FN3O3S2 |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-[(4-methylphenyl)sulfonylamino]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C22H28FN3O3S2/c1-16-5-8-18(9-6-16)31(28,29)25-20(11-14-30-2)22(27)24-17-7-10-21(19(23)15-17)26-12-3-4-13-26/h5-10,15,20,25H,3-4,11-14H2,1-2H3,(H,24,27) |
| InChIKey | KLCAMQZLSVPMIO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|