C15H23NO4S2 — CID 35767120
(2S)-2-[(4-tert-butylphenyl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 35767120) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (2S)-2-[(4-tert-butylphenyl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(4-tert-butylphenyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 35767120 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2S)-2-[(4-tert-butylphenyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NS(=O)(=O)c1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C15H23NO4S2/c1-15(2,3)11-5-7-12(8-6-11)22(19,20)16-13(14(17)18)9-10-21-4/h5-8,13,16H,9-10H2,1-4H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | VMWPZNUUHUVDSP-ZDUSSCGKSA-N |
| XLogP | 2.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |