C25H36N2O6S2 — CID 135183823
2,5-bis[(4-tert-butylphenyl)sulfonylamino]pentanoic acid (PubChem CID 135183823) has the molecular formula C25H36N2O6S2 and a molecular weight of 524.71 g/mol. Its IUPAC name is 2,5-bis[(4-tert-butylphenyl)sulfonylamino]pentanoic acid.
| Compound Name | 2,5-bis[(4-tert-butylphenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 135183823 |
| Molecular Formula | C25H36N2O6S2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2,5-bis[(4-tert-butylphenyl)sulfonylamino]pentanoic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCCC(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H36N2O6S2/c1-24(2,3)18-9-13-20(14-10-18)34(30,31)26-17-7-8-22(23(28)29)27-35(32,33)21-15-11-19(12-16-21)25(4,5)6/h9-16,22,26-27H,7-8,17H2,1-6H3,(H,28,29) |
| InChIKey | RETKXRDFSQSTQW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|