C18H20Br2N2O6S2 — CID 86604364
(2S)-2,6-bis[(4-bromophenyl)sulfonylamino]hexanoic acid (PubChem CID 86604364) has the molecular formula C18H20Br2N2O6S2 and a molecular weight of 584.31 g/mol. Its IUPAC name is (2S)-2,6-bis[(4-bromophenyl)sulfonylamino]hexanoic acid.
| Compound Name | (2S)-2,6-bis[(4-bromophenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 86604364 |
| Molecular Formula | C18H20Br2N2O6S2 |
| Molecular Weight | 584.31 g/mol |
| Exact Mass | 581.91 |
| IUPAC Name | (2S)-2,6-bis[(4-bromophenyl)sulfonylamino]hexanoic acid |
| SMILES | O=C(O)[C@H](CCCCNS(=O)(=O)c1ccc(Br)cc1)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H20Br2N2O6S2/c19-13-4-8-15(9-5-13)29(25,26)21-12-2-1-3-17(18(23)24)22-30(27,28)16-10-6-14(20)7-11-16/h4-11,17,21-22H,1-3,12H2,(H,23,24)/t17-/m0/s1 |
| InChIKey | MNFIXKOUKUIAKO-KRWDZBQOSA-N |
| XLogP | 3.09 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|