C26H28BrN3O7S2 — CID 23288409
6-[(4-acetamidophenyl)sulfonylamino]-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]hexanoic acid (PubChem CID 23288409) has the molecular formula C26H28BrN3O7S2 and a molecular weight of 638.56 g/mol. Its IUPAC name is 6-[(4-acetamidophenyl)sulfonylamino]-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]hexanoic acid.
| Compound Name | 6-[(4-acetamidophenyl)sulfonylamino]-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 23288409 |
| Molecular Formula | C26H28BrN3O7S2 |
| Molecular Weight | 638.56 g/mol |
| Exact Mass | 637.06 |
| IUPAC Name | 6-[(4-acetamidophenyl)sulfonylamino]-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]hexanoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCCCC(NS(=O)(=O)c2ccc(-c3ccc(Br)cc3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H28BrN3O7S2/c1-18(31)29-22-11-15-23(16-12-22)38(34,35)28-17-3-2-4-25(26(32)33)30-39(36,37)24-13-7-20(8-14-24)19-5-9-21(27)10-6-19/h5-16,25,28,30H,2-4,17H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | PDDOKSGSYBRHKK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|