C27H29BrN2O5S — CID 10816934
(2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-6-(3-phenylpropanoylamino)hexanoic acid (PubChem CID 10816934) has the molecular formula C27H29BrN2O5S and a molecular weight of 573.51 g/mol. Its IUPAC name is (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-6-(3-phenylpropanoylamino)hexanoic acid.
| Compound Name | (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-6-(3-phenylpropanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 10816934 |
| Molecular Formula | C27H29BrN2O5S |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | (2S)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-6-(3-phenylpropanoylamino)hexanoic acid |
| SMILES | O=C(CCc1ccccc1)NCCCC[C@H](NS(=O)(=O)c1ccc(-c2ccc(Br)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H29BrN2O5S/c28-23-14-10-21(11-15-23)22-12-16-24(17-13-22)36(34,35)30-25(27(32)33)8-4-5-19-29-26(31)18-9-20-6-2-1-3-7-20/h1-3,6-7,10-17,25,30H,4-5,8-9,18-19H2,(H,29,31)(H,32,33)/t25-/m0/s1 |
| InChIKey | NZVNFHULUBKMQI-VWLOTQADSA-N |
| XLogP | 4.77 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|