C22H28N2O6S — CID 54264937
(2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(4-phenylphenyl)sulfonylamino]pentanoic acid (PubChem CID 54264937) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(4-phenylphenyl)sulfonylamino]pentanoic acid.
| Compound Name | (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(4-phenylphenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 54264937 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(4-phenylphenyl)sulfonylamino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](NS(=O)(=O)c1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H28N2O6S/c1-22(2,3)30-21(27)23-15-7-10-19(20(25)26)24-31(28,29)18-13-11-17(12-14-18)16-8-5-4-6-9-16/h4-6,8-9,11-14,19,24H,7,10,15H2,1-3H3,(H,23,27)(H,25,26)/t19-/m0/s1 |
| InChIKey | RGCKEDCGYWNMLM-IBGZPJMESA-N |
| XLogP | 3.39 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|