C28H39N3O7S — CID 21348257
tert-butyl 2-[(4-benzamidophenyl)sulfonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 21348257) has the molecular formula C28H39N3O7S and a molecular weight of 561.70 g/mol. Its IUPAC name is tert-butyl 2-[(4-benzamidophenyl)sulfonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | tert-butyl 2-[(4-benzamidophenyl)sulfonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 21348257 |
| Molecular Formula | C28H39N3O7S |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | tert-butyl 2-[(4-benzamidophenyl)sulfonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(NS(=O)(=O)c1ccc(NC(=O)c2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H39N3O7S/c1-27(2,3)37-25(33)23(14-10-11-19-29-26(34)38-28(4,5)6)31-39(35,36)22-17-15-21(16-18-22)30-24(32)20-12-8-7-9-13-20/h7-9,12-13,15-18,23,31H,10-11,14,19H2,1-6H3,(H,29,34)(H,30,32) |
| InChIKey | ZSAOMAIDLVFXAM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|