C20H26N2O4S — CID 75113060
tert-butyl 4-amino-2-[(4-phenylphenyl)sulfonylamino]butanoate (PubChem CID 75113060) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is tert-butyl 4-amino-2-[(4-phenylphenyl)sulfonylamino]butanoate.
| Compound Name | tert-butyl 4-amino-2-[(4-phenylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 75113060 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | tert-butyl 4-amino-2-[(4-phenylphenyl)sulfonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)C(CCN)NS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O4S/c1-20(2,3)26-19(23)18(13-14-21)22-27(24,25)17-11-9-16(10-12-17)15-7-5-4-6-8-15/h4-12,18,22H,13-14,21H2,1-3H3 |
| InChIKey | SAEUSWVHLOFFSJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |