C28H35NO6S — CID 67589850
ditert-butyl (2R)-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylamino]pentanedioate (PubChem CID 67589850) has the molecular formula C28H35NO6S and a molecular weight of 513.66 g/mol. Its IUPAC name is ditert-butyl (2R)-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylamino]pentanedioate.
| Compound Name | ditert-butyl (2R)-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylamino]pentanedioate |
|---|---|
| PubChem CID | 67589850 |
| Molecular Formula | C28H35NO6S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | ditert-butyl (2R)-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylamino]pentanedioate |
| SMILES | Cc1ccc(C#Cc2ccc(S(=O)(=O)N[C@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H35NO6S/c1-20-8-10-21(11-9-20)12-13-22-14-16-23(17-15-22)36(32,33)29-24(26(31)35-28(5,6)7)18-19-25(30)34-27(2,3)4/h8-11,14-17,24,29H,18-19H2,1-7H3/t24-/m1/s1 |
| InChIKey | OKTWVEDERHCUHV-XMMPIXPASA-N |
| XLogP | 4.51 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|