C12H14LiNO6S — CID 171479381
lithium (2S)-5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoate (PubChem CID 171479381) has the molecular formula C12H14LiNO6S and a molecular weight of 307.25 g/mol. Its IUPAC name is lithium (2S)-5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoate.
| Compound Name | lithium (2S)-5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 171479381 |
| Molecular Formula | C12H14LiNO6S |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | lithium (2S)-5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCC(=O)O)C(=O)[O-])cc1.[Li+] |
| InChI | InChI=1S/C12H15NO6S.Li/c1-8-2-4-9(5-3-8)20(18,19)13-10(12(16)17)6-7-11(14)15;/h2-5,10,13H,6-7H2,1H3,(H,14,15)(H,16,17);/q;+1/p-1/t10-;/m0./s1 |
| InChIKey | LEZXOAYVFOUCQE-PPHPATTJSA-M |
| XLogP | -3.74 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |