C12H15NO6S2 — CID 2298857
(2S)-3-(carboxymethylsulfanyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 2298857) has the molecular formula C12H15NO6S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (2S)-3-(carboxymethylsulfanyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-(carboxymethylsulfanyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 2298857 |
| Molecular Formula | C12H15NO6S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | (2S)-3-(carboxymethylsulfanyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CSCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO6S2/c1-8-2-4-9(5-3-8)21(18,19)13-10(12(16)17)6-20-7-11(14)15/h2-5,10,13H,6-7H2,1H3,(H,14,15)(H,16,17)/t10-/m1/s1 |
| InChIKey | CRMPEPZYWLJTPR-SNVBAGLBSA-N |
| XLogP | 0.54 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |