C17H20N2O6S2 — CID 44722108
(2S)-2,3-bis[(4-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 44722108) has the molecular formula C17H20N2O6S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2S)-2,3-bis[(4-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-2,3-bis[(4-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 44722108 |
| Molecular Formula | C17H20N2O6S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (2S)-2,3-bis[(4-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@H](NS(=O)(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H20N2O6S2/c1-12-3-7-14(8-4-12)26(22,23)18-11-16(17(20)21)19-27(24,25)15-9-5-13(2)6-10-15/h3-10,16,18-19H,11H2,1-2H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | NLKSLZJFFPKVBQ-INIZCTEOSA-N |
| XLogP | 1.01 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |