C9H12BrNO3S — CID 141352763
N-(2-bromo-2-hydroxyethyl)-4-methylbenzenesulfonamide (PubChem CID 141352763) has the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. Its IUPAC name is N-(2-bromo-2-hydroxyethyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2-bromo-2-hydroxyethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 141352763 |
| Molecular Formula | C9H12BrNO3S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | N-(2-bromo-2-hydroxyethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(O)Br)cc1 |
| InChI | InChI=1S/C9H12BrNO3S/c1-7-2-4-8(5-3-7)15(13,14)11-6-9(10)12/h2-5,9,11-12H,6H2,1H3 |
| InChIKey | MDAMINIGBUIEOT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|