C16H19NO4S — CID 12032646
N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 12032646) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 12032646 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(C(O)CNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H19NO4S/c1-12-3-9-15(10-4-12)22(19,20)17-11-16(18)13-5-7-14(21-2)8-6-13/h3-10,16-18H,11H2,1-2H3 |
| InChIKey | KRVWHAVMIIJDCJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |